Organic oxoazanium compounds
Aobchem 1 3-Difluoro-2-nitrobenzene | ≥95% | CAS 19064-24-5 | C6H3F2NO2 | 10g
1 3-Difluoro-2-nitrobenzene | ≥95% | CAS 19064-24-5 | C6H3F2NO2 | 10g
![eMolecules 1146290-36-9 | 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 25g | 882684745](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
eMolecules 1146290-36-9 | 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 25g | 882684745
2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | 1146290-36-9 | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 25g | 882684745
Accela Chembio Inc 6-nitrophthalide | 25g | 610-93-5 | MFCD00033529 | 97+% | Shelf Life: 540 Days | Light Sensitive
6-nitrophthalide | 25g | 610-93-5 | MFCD00033529 | 97+% | Shelf Life: 540 Days | Light Sensitive
Accela Chembio Inc MF: C8H3N3O2 | MW: 173.13 | ?98% | Flash Point: 187.3? | BP: 386.1? at 760 mmHg.
MF: C8H3N3O2 | MW: 173.13 | ?98% | Flash Point: 187.3? | BP: 386.1? at 760 mmHg.
Accela Chembio Inc 5-nitroindole | 100g | 6146-52-7 | MFCD00005673 | 97+% | Shelf Life: 1080 Days | Light Sensitive
5-nitroindole | 100g | 6146-52-7 | MFCD00005673 | 97+% | Shelf Life: 1080 Days | Light Sensitive
Matrix Scientific 3-FLUORONITROBENZENE-25G
3-Fluoronitrobenzene, 97%; 25g,C6H4FNO2, MFCD00007196, mw 141.10, [402-67-5]
Cambridge Isotope Laboratories NITROBENZENE (13C6, 99%), 0.25 G, 89059-37-0
NITROBENZENE (13C6, 99%), 0.25 G, 89059-37-0
=O | 25g | 571107374](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502142014.JPG-250.jpg)
eMolecules 70102-34-0 | 3-Nitrobenzene-1-carbothioamide | Oakwood Chemical | MFCD09757586 | 182.200 | C7H6N2O2S | 95.000 | NC(=S)c1cccc(c1)[N+]([O-])=O | 25g | 571107374
3-Nitrobenzene-1-carbothioamide | Oakwood Chemical | 70102-34-0 | MFCD09757586 | 182.200 | C7H6N2O2S | 95.000 | NC(=S)c1cccc(c1)[N+]([O-])=O | 25g | 571107374
Sigma Aldrich Fine Chemicals Biosciences Nitromethane ACS reagent 91L
REAGENT Nitromethane ACS reagent 91L
Chem-Impex International, Inc. 4-Fluoro-3-nitrobenzonitrile | 1009-35-4 | MFCD01632197 | 25G
4-Fluoro-3-nitrobenzonitrile, 1009-35-4, MFCD01632197, 25G
eMolecules 15846-14-7 | Ambeed | 46-Dimethoxy-5-nitropyrimidine | 1g | 525054836 | A144538 | MFCD00129731 | 185.139 | C6H7N3O4
Ambeed | (3-(Cyanomethyl)phenyl)boronic acid | 100mg | 552575883 | A139997 | 220616-39-7 | MFCD03788026 | 160.970 | C8H8BNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem 2-Isopropoxy-5-methoxy-benzaldehyde | ≥97% | CAS 75792-36-8 | C11H14O3 | 5g
2-Isopropoxy-5-methoxy-benzaldehyde | ≥97% | CAS 75792-36-8 | C11H14O3 | 5g
Aobchem 1 4-Diiodo-2-nitrobenzene | ≥95% | CAS 89488-57-3 | C6H3I2NO2 | 5g
1 4-Diiodo-2-nitrobenzene | ≥95% | CAS 89488-57-3 | C6H3I2NO2 | 5g
Aobchem 3-Bromo-5-nitrobenzonitrile | ≥97% | CAS 49674-15-9 | C7H3BrN2O2 | 5g
3-Bromo-5-nitrobenzonitrile | ≥97% | CAS 49674-15-9 | C7H3BrN2O2 | 5g
Aobchem 2-Isopropoxy-5-methoxy-benzaldehyde | ≥97% | CAS 75792-36-8 | C11H14O3 | 500mg
2-Isopropoxy-5-methoxy-benzaldehyde | ≥97% | CAS 75792-36-8 | C11H14O3 | 500mg